| Name | 3-(3-methoxyphenyl)propionic acid |
| Synonyms | 3-Methoxyhydrocinnamic acid M-METHOXYHYDROCINNAMIC ACID 3-(3-methoxyphenyl)propionic acid 3-(3-METHOXYPHENYL)PROPANOIC ACID 3-(3-methoxyphenyl)propanoic acid Benzenepropanoic acid, 3-methoxy- 3-(3-METHOXYPHENYL)PROPIONIC ACID β-(m-Methoxyphenyl)propionic acid beta-(m-Methoxyphenyl)propionic acid |
| CAS | 10516-71-9 |
| EINECS | 234-049-6 |
| InChI | InChI=1/C10H12O3/c1-13-9-4-2-3-8(7-9)5-6-10(11)12/h2-4,7H,5-6H2,1H3,(H,11,12) |
| Molecular Formula | C10H12O3 |
| Molar Mass | 180.2 |
| Density | 1.144±0.06 g/cm3(Predicted) |
| Melting Point | 43-45 °C (lit.) |
| Boling Point | 318.1±17.0 °C(Predicted) |
| Flash Point | 125.6°C |
| Water Solubility | Soluble in water. |
| Vapor Presure | 0.000155mmHg at 25°C |
| Appearance | White crystal |
| BRN | 1874422 |
| pKa | pK1:4.654 (25°C) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.53 |
| MDL | MFCD00014027 |
| Physical and Chemical Properties | White crystal. Melting point 50-51 ℃. |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| HS Code | 29189900 |
| Hazard Class | IRRITANT |
| biological activity | 3-(3-Methoxyphenyl)propionic acid is a naturally occurring human metabolite, which is an organic acid excreted in urine. |
| target | Human Endogenous Metabolite |
| chemical properties | white crystal. Melting point 50-51 ℃. |